C17H36O4Si2 — CID 174980668
diethoxy-bis(prop-2-enyl)silane;ethenyl-diethoxy-methylsilane (PubChem CID 174980668) has the molecular formula C17H36O4Si2 and a molecular weight of 360.64 g/mol. Its IUPAC name is diethoxy-bis(prop-2-enyl)silane;ethenyl-diethoxy-methylsilane.
| Compound Name | diethoxy-bis(prop-2-enyl)silane;ethenyl-diethoxy-methylsilane |
|---|---|
| PubChem CID | 174980668 |
| Molecular Formula | C17H36O4Si2 |
| Molecular Weight | 360.64 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | diethoxy-bis(prop-2-enyl)silane;ethenyl-diethoxy-methylsilane |
| SMILES | C=CC[Si](CC=C)(OCC)OCC.C=C[Si](C)(OCC)OCC |
| InChI | InChI=1S/C10H20O2Si.C7H16O2Si/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-5-8-10(4,7-3)9-6-2/h5-6H,1-2,7-10H2,3-4H3;7H,3,5-6H2,1-2,4H3 |
| InChIKey | MACURDUILSNSOA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|