C11H24O2Si — CID 91723235
ethenyl-ethoxy-methyl-(4-methylpentan-2-yloxy)silane (PubChem CID 91723235) has the molecular formula C11H24O2Si and a molecular weight of 216.40 g/mol. Its IUPAC name is ethenyl-ethoxy-methyl-(4-methylpentan-2-yloxy)silane.
| Compound Name | ethenyl-ethoxy-methyl-(4-methylpentan-2-yloxy)silane |
|---|---|
| PubChem CID | 91723235 |
| Molecular Formula | C11H24O2Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | ethenyl-ethoxy-methyl-(4-methylpentan-2-yloxy)silane |
| SMILES | C=C[Si](C)(OCC)OC(C)CC(C)C |
| InChI | InChI=1S/C11H24O2Si/c1-7-12-14(6,8-2)13-11(5)9-10(3)4/h8,10-11H,2,7,9H2,1,3-6H3 |
| InChIKey | XXIZEEIUZMYLJW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|