C14H30O2Si — CID 91734928
2,4-dimethylpentan-3-yloxy-ethenyl-methyl-(2-methylpropoxy)silane (PubChem CID 91734928) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yloxy-ethenyl-methyl-(2-methylpropoxy)silane.
| Compound Name | 2,4-dimethylpentan-3-yloxy-ethenyl-methyl-(2-methylpropoxy)silane |
|---|---|
| PubChem CID | 91734928 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2,4-dimethylpentan-3-yloxy-ethenyl-methyl-(2-methylpropoxy)silane |
| SMILES | C=C[Si](C)(OCC(C)C)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-9-17(8,15-10-11(2)3)16-14(12(4)5)13(6)7/h9,11-14H,1,10H2,2-8H3 |
| InChIKey | JVPQWELHHWJXKR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|