C22H46O3Si2 — CID 91741576
2,4-dimethylpentan-3-yloxy-ethenyl-(ethenyl-methyl-nonoxysilyl)oxy-methylsilane (PubChem CID 91741576) has the molecular formula C22H46O3Si2 and a molecular weight of 414.78 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yloxy-ethenyl-(ethenyl-methyl-nonoxysilyl)oxy-methylsilane.
| Compound Name | 2,4-dimethylpentan-3-yloxy-ethenyl-(ethenyl-methyl-nonoxysilyl)oxy-methylsilane |
|---|---|
| PubChem CID | 91741576 |
| Molecular Formula | C22H46O3Si2 |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 2,4-dimethylpentan-3-yloxy-ethenyl-(ethenyl-methyl-nonoxysilyl)oxy-methylsilane |
| SMILES | C=C[Si](C)(OCCCCCCCCC)O[Si](C)(C=C)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C22H46O3Si2/c1-10-13-14-15-16-17-18-19-23-26(8,11-2)25-27(9,12-3)24-22(20(4)5)21(6)7/h11-12,20-22H,2-3,10,13-19H2,1,4-9H3 |
| InChIKey | OBOPAIDYYLWOFC-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|