C21H44O3Si2 — CID 91740164
ethenyl-(ethenyl-heptoxy-methylsilyl)oxy-methyl-octan-4-yloxysilane (PubChem CID 91740164) has the molecular formula C21H44O3Si2 and a molecular weight of 400.75 g/mol. Its IUPAC name is ethenyl-(ethenyl-heptoxy-methylsilyl)oxy-methyl-octan-4-yloxysilane.
| Compound Name | ethenyl-(ethenyl-heptoxy-methylsilyl)oxy-methyl-octan-4-yloxysilane |
|---|---|
| PubChem CID | 91740164 |
| Molecular Formula | C21H44O3Si2 |
| Molecular Weight | 400.75 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | ethenyl-(ethenyl-heptoxy-methylsilyl)oxy-methyl-octan-4-yloxysilane |
| SMILES | C=C[Si](C)(OCCCCCCC)O[Si](C)(C=C)OC(CCC)CCCC |
| InChI | InChI=1S/C21H44O3Si2/c1-8-13-15-16-17-20-22-25(6,11-4)24-26(7,12-5)23-21(18-10-3)19-14-9-2/h11-12,21H,4-5,8-10,13-20H2,1-3,6-7H3 |
| InChIKey | CTFCPIWTYSTTIZ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.75 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|