C12H26OSi2 — CID 139725530
ethyl-(ethyl-methyl-prop-2-enylsilyl)oxy-methyl-prop-2-enylsilane (PubChem CID 139725530) has the molecular formula C12H26OSi2 and a molecular weight of 242.51 g/mol. Its IUPAC name is ethyl-(ethyl-methyl-prop-2-enylsilyl)oxy-methyl-prop-2-enylsilane.
| Compound Name | ethyl-(ethyl-methyl-prop-2-enylsilyl)oxy-methyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 139725530 |
| Molecular Formula | C12H26OSi2 |
| Molecular Weight | 242.51 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | ethyl-(ethyl-methyl-prop-2-enylsilyl)oxy-methyl-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(CC)O[Si](C)(CC)CC=C |
| InChI | InChI=1S/C12H26OSi2/c1-7-11-14(5,9-3)13-15(6,10-4)12-8-2/h7-8H,1-2,9-12H2,3-6H3 |
| InChIKey | FMPZJLMOECCRET-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|