C6H14F2OSi2 — CID 15738804
difluoro-prop-2-enyl-trimethylsilyloxysilane (PubChem CID 15738804) has the molecular formula C6H14F2OSi2 and a molecular weight of 196.34 g/mol. Its IUPAC name is difluoro-prop-2-enyl-trimethylsilyloxysilane.
| Compound Name | difluoro-prop-2-enyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 15738804 |
| Molecular Formula | C6H14F2OSi2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | difluoro-prop-2-enyl-trimethylsilyloxysilane |
| SMILES | C=CC[Si](F)(F)O[Si](C)(C)C |
| InChI | InChI=1S/C6H14F2OSi2/c1-5-6-11(7,8)9-10(2,3)4/h5H,1,6H2,2-4H3 |
| InChIKey | NWIPLJYXMQFSSU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|