C10H24OSi2 — CID 14223255
[dimethyl(prop-2-enyl)silyl]oxy-dimethyl-propylsilane (PubChem CID 14223255) has the molecular formula C10H24OSi2 and a molecular weight of 216.47 g/mol. Its IUPAC name is [dimethyl(prop-2-enyl)silyl]oxy-dimethyl-propylsilane.
| Compound Name | [dimethyl(prop-2-enyl)silyl]oxy-dimethyl-propylsilane |
|---|---|
| PubChem CID | 14223255 |
| Molecular Formula | C10H24OSi2 |
| Molecular Weight | 216.47 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | [dimethyl(prop-2-enyl)silyl]oxy-dimethyl-propylsilane |
| SMILES | C=CC[Si](C)(C)O[Si](C)(C)CCC |
| InChI | InChI=1S/C10H24OSi2/c1-7-9-12(3,4)11-13(5,6)10-8-2/h7H,1,8-10H2,2-6H3 |
| InChIKey | VREFQBVFTVOPHO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|