C11H26O2Si3 — CID 173191549
[[dimethyl(prop-2-enyl)silyl]oxy-silylmethoxy]-dimethyl-prop-2-enylsilane (PubChem CID 173191549) has the molecular formula C11H26O2Si3 and a molecular weight of 274.59 g/mol. Its IUPAC name is [[dimethyl(prop-2-enyl)silyl]oxy-silylmethoxy]-dimethyl-prop-2-enylsilane.
| Compound Name | [[dimethyl(prop-2-enyl)silyl]oxy-silylmethoxy]-dimethyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 173191549 |
| Molecular Formula | C11H26O2Si3 |
| Molecular Weight | 274.59 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [[dimethyl(prop-2-enyl)silyl]oxy-silylmethoxy]-dimethyl-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(C)OC([SiH3])O[Si](C)(C)CC=C |
| InChI | InChI=1S/C11H26O2Si3/c1-7-9-15(3,4)12-11(14)13-16(5,6)10-8-2/h7-8,11H,1-2,9-10H2,3-6,14H3 |
| InChIKey | AVNIDJKURLOOBH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|