C13H26O2Si3 — CID 140841424
[dimethyl(prop-2-enyl)silyl]oxy-dimethyl-tris(ethenyl)silyloxysilane (PubChem CID 140841424) has the molecular formula C13H26O2Si3 and a molecular weight of 298.61 g/mol. Its IUPAC name is [dimethyl(prop-2-enyl)silyl]oxy-dimethyl-tris(ethenyl)silyloxysilane.
| Compound Name | [dimethyl(prop-2-enyl)silyl]oxy-dimethyl-tris(ethenyl)silyloxysilane |
|---|---|
| PubChem CID | 140841424 |
| Molecular Formula | C13H26O2Si3 |
| Molecular Weight | 298.61 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [dimethyl(prop-2-enyl)silyl]oxy-dimethyl-tris(ethenyl)silyloxysilane |
| SMILES | C=CC[Si](C)(C)O[Si](C)(C)O[Si](C=C)(C=C)C=C |
| InChI | InChI=1S/C13H26O2Si3/c1-9-13-16(5,6)14-17(7,8)15-18(10-2,11-3)12-4/h9-12H,1-4,13H2,5-8H3 |
| InChIKey | RUVALYNLFOWAHP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|