C13H32O3Si4 — CID 59883880
[dimethyl(prop-2-enyl)silyl]oxy-[[dimethyl(prop-2-enyl)silyl]oxy-methylsilyl]oxy-dimethylsilane (PubChem CID 59883880) has the molecular formula C13H32O3Si4 and a molecular weight of 348.74 g/mol. Its IUPAC name is [dimethyl(prop-2-enyl)silyl]oxy-[[dimethyl(prop-2-enyl)silyl]oxy-methylsilyl]oxy-dimethylsilane.
| Compound Name | [dimethyl(prop-2-enyl)silyl]oxy-[[dimethyl(prop-2-enyl)silyl]oxy-methylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 59883880 |
| Molecular Formula | C13H32O3Si4 |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [dimethyl(prop-2-enyl)silyl]oxy-[[dimethyl(prop-2-enyl)silyl]oxy-methylsilyl]oxy-dimethylsilane |
| SMILES | C=CC[Si](C)(C)O[SiH](C)O[Si](C)(C)O[Si](C)(C)CC=C |
| InChI | InChI=1S/C13H32O3Si4/c1-10-12-18(4,5)14-17(3)15-20(8,9)16-19(6,7)13-11-2/h10-11,17H,1-2,12-13H2,3-9H3 |
| InChIKey | UGJMAEODYORIKE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|