C20H54O4Si6 — CID 162248160
dimethylsilyloxy-[8-[[dimethylsilyloxy(dimethyl)silyl]oxy-dimethylsilyl]octyl-dimethylsilyl]oxy-dimethylsilane (PubChem CID 162248160) has the molecular formula C20H54O4Si6 and a molecular weight of 527.16 g/mol. Its IUPAC name is dimethylsilyloxy-[8-[[dimethylsilyloxy(dimethyl)silyl]oxy-dimethylsilyl]octyl-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | dimethylsilyloxy-[8-[[dimethylsilyloxy(dimethyl)silyl]oxy-dimethylsilyl]octyl-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 162248160 |
| Molecular Formula | C20H54O4Si6 |
| Molecular Weight | 527.16 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | dimethylsilyloxy-[8-[[dimethylsilyloxy(dimethyl)silyl]oxy-dimethylsilyl]octyl-dimethylsilyl]oxy-dimethylsilane |
| SMILES | C[SiH](C)O[Si](C)(C)O[Si](C)(C)CCCCCCCC[Si](C)(C)O[Si](C)(C)O[SiH](C)C |
| InChI | InChI=1S/C20H54O4Si6/c1-25(2)21-29(9,10)23-27(5,6)19-17-15-13-14-16-18-20-28(7,8)24-30(11,12)22-26(3)4/h25-26H,13-20H2,1-12H3 |
| InChIKey | ZXPXCMPGOIGFRH-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.16 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|