C15H38O3Si3 — CID 20732733
8-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]octan-1-ol (PubChem CID 20732733) has the molecular formula C15H38O3Si3 and a molecular weight of 350.72 g/mol. Its IUPAC name is 8-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]octan-1-ol.
| Compound Name | 8-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]octan-1-ol |
|---|---|
| PubChem CID | 20732733 |
| Molecular Formula | C15H38O3Si3 |
| Molecular Weight | 350.72 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 8-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]octan-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCCCCCCO |
| InChI | InChI=1S/C15H38O3Si3/c1-19(2,3)17-21(6,7)18-20(4,5)15-13-11-9-8-10-12-14-16/h16H,8-15H2,1-7H3 |
| InChIKey | DCEZDYJEFJFACD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|