C23H62O6Si7 — CID 90386618
[dimethyl(octyl)silyl]oxy-dimethyl-trimethylsilyloxysilane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 90386618) has the molecular formula C23H62O6Si7 and a molecular weight of 631.35 g/mol. Its IUPAC name is [dimethyl(octyl)silyl]oxy-dimethyl-trimethylsilyloxysilane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | [dimethyl(octyl)silyl]oxy-dimethyl-trimethylsilyloxysilane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 90386618 |
| Molecular Formula | C23H62O6Si7 |
| Molecular Weight | 631.35 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | [dimethyl(octyl)silyl]oxy-dimethyl-trimethylsilyloxysilane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCCCCCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C.C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C15H38O2Si3.C8H24O4Si4/c1-9-10-11-12-13-14-15-19(5,6)17-20(7,8)16-18(2,3)4;1-13(2)9-14(3,4)11-16(7,8)12-15(5,6)10-13/h9-15H2,1-8H3;1-8H3 |
| InChIKey | UKDLTHQVPBXJQL-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.35 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|