C26H68N2O4Si6 — CID 102274168
N,N'-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]hexane-1,6-diamine (PubChem CID 102274168) has the molecular formula C26H68N2O4Si6 and a molecular weight of 641.36 g/mol. Its IUPAC name is N,N'-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]hexane-1,6-diamine.
| Compound Name | N,N'-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 102274168 |
| Molecular Formula | C26H68N2O4Si6 |
| Molecular Weight | 641.36 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | N,N'-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]hexane-1,6-diamine |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCNCCCCCCNCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H68N2O4Si6/c1-33(2,3)29-37(11,12)31-35(7,8)25-19-23-27-21-17-15-16-18-22-28-24-20-26-36(9,10)32-38(13,14)30-34(4,5)6/h27-28H,15-26H2,1-14H3 |
| InChIKey | SGBFEXLCISSIDX-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.36 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|