C14H38N2O2Si3 — CID 167538269
4-[[[dimethyl-[3-(methylamino)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]butan-1-amine (PubChem CID 167538269) has the molecular formula C14H38N2O2Si3 and a molecular weight of 350.73 g/mol. Its IUPAC name is 4-[[[dimethyl-[3-(methylamino)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]butan-1-amine.
| Compound Name | 4-[[[dimethyl-[3-(methylamino)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]butan-1-amine |
|---|---|
| PubChem CID | 167538269 |
| Molecular Formula | C14H38N2O2Si3 |
| Molecular Weight | 350.73 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 4-[[[dimethyl-[3-(methylamino)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]butan-1-amine |
| SMILES | CNCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCCN |
| InChI | InChI=1S/C14H38N2O2Si3/c1-16-12-10-14-20(4,5)18-21(6,7)17-19(2,3)13-9-8-11-15/h16H,8-15H2,1-7H3 |
| InChIKey | IIMIPHVAFNLZLP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|