C13H32N4O3Si2 — CID 59079127
3-[[4-(carbamoylamino)butyl-dimethylsilyl]oxy-dimethylsilyl]propylurea (PubChem CID 59079127) has the molecular formula C13H32N4O3Si2 and a molecular weight of 348.60 g/mol. Its IUPAC name is 3-[[4-(carbamoylamino)butyl-dimethylsilyl]oxy-dimethylsilyl]propylurea.
| Compound Name | 3-[[4-(carbamoylamino)butyl-dimethylsilyl]oxy-dimethylsilyl]propylurea |
|---|---|
| PubChem CID | 59079127 |
| Molecular Formula | C13H32N4O3Si2 |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-[[4-(carbamoylamino)butyl-dimethylsilyl]oxy-dimethylsilyl]propylurea |
| SMILES | C[Si](C)(CCCCNC(N)=O)O[Si](C)(C)CCCNC(N)=O |
| InChI | InChI=1S/C13H32N4O3Si2/c1-21(2,10-6-5-8-16-12(14)18)20-22(3,4)11-7-9-17-13(15)19/h5-11H2,1-4H3,(H3,14,16,18)(H3,15,17,19) |
| InChIKey | KHJLPMSQNSLHNT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|