C22H40N2O9Si2 — CID 140879603
2-[3-[[dimethyl-[3-(2-prop-2-enoyloxyethoxycarbonylamino)propyl]silyl]oxy-dimethylsilyl]propylcarbamoyloxy]ethyl prop-2-enoate (PubChem CID 140879603) has the molecular formula C22H40N2O9Si2 and a molecular weight of 532.74 g/mol. Its IUPAC name is 2-[3-[[dimethyl-[3-(2-prop-2-enoyloxyethoxycarbonylamino)propyl]silyl]oxy-dimethylsilyl]propylcarbamoyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[3-[[dimethyl-[3-(2-prop-2-enoyloxyethoxycarbonylamino)propyl]silyl]oxy-dimethylsilyl]propylcarbamoyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 140879603 |
| Molecular Formula | C22H40N2O9Si2 |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 2-[3-[[dimethyl-[3-(2-prop-2-enoyloxyethoxycarbonylamino)propyl]silyl]oxy-dimethylsilyl]propylcarbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)NCCC[Si](C)(C)O[Si](C)(C)CCCNC(=O)OCCOC(=O)C=C |
| InChI | InChI=1S/C22H40N2O9Si2/c1-7-19(25)29-13-15-31-21(27)23-11-9-17-34(3,4)33-35(5,6)18-10-12-24-22(28)32-16-14-30-20(26)8-2/h7-8H,1-2,9-18H2,3-6H3,(H,23,27)(H,24,28) |
| InChIKey | KXTLRECNPMLCDG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|