C11H24O6Si2 — CID 22726207
3-[dimethyl(trimethoxysilyloxy)silyl]propyl prop-2-enoate (PubChem CID 22726207) has the molecular formula C11H24O6Si2 and a molecular weight of 308.48 g/mol. Its IUPAC name is 3-[dimethyl(trimethoxysilyloxy)silyl]propyl prop-2-enoate.
| Compound Name | 3-[dimethyl(trimethoxysilyloxy)silyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 22726207 |
| Molecular Formula | C11H24O6Si2 |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-[dimethyl(trimethoxysilyloxy)silyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](C)(C)O[Si](OC)(OC)OC |
| InChI | InChI=1S/C11H24O6Si2/c1-7-11(12)16-9-8-10-18(5,6)17-19(13-2,14-3)15-4/h7H,1,8-10H2,2-6H3 |
| InChIKey | UAVOGBNTXPSHRR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|