C15H27Cl3O6Si2 — CID 87857692
3-[dimethoxy(methyl)silyl]propyl prop-2-enoate;3-trichlorosilylpropyl prop-2-enoate (PubChem CID 87857692) has the molecular formula C15H27Cl3O6Si2 and a molecular weight of 465.91 g/mol. Its IUPAC name is 3-[dimethoxy(methyl)silyl]propyl prop-2-enoate;3-trichlorosilylpropyl prop-2-enoate.
| Compound Name | 3-[dimethoxy(methyl)silyl]propyl prop-2-enoate;3-trichlorosilylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 87857692 |
| Molecular Formula | C15H27Cl3O6Si2 |
| Molecular Weight | 465.91 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propyl prop-2-enoate;3-trichlorosilylpropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](C)(OC)OC.C=CC(=O)OCCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C9H18O4Si.C6H9Cl3O2Si/c1-5-9(10)13-7-6-8-14(4,11-2)12-3;1-2-6(10)11-4-3-5-12(7,8)9/h5H,1,6-8H2,2-4H3;2H,1,3-5H2 |
| InChIKey | WDJJMGJZFDCHAM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|