C11H22O4Si — CID 172555939
3-(methoxy-methyl-propoxysilyl)propyl prop-2-enoate (PubChem CID 172555939) has the molecular formula C11H22O4Si and a molecular weight of 246.38 g/mol. Its IUPAC name is 3-(methoxy-methyl-propoxysilyl)propyl prop-2-enoate.
| Compound Name | 3-(methoxy-methyl-propoxysilyl)propyl prop-2-enoate |
|---|---|
| PubChem CID | 172555939 |
| Molecular Formula | C11H22O4Si |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 3-(methoxy-methyl-propoxysilyl)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](C)(OC)OCCC |
| InChI | InChI=1S/C11H22O4Si/c1-5-8-15-16(4,13-3)10-7-9-14-11(12)6-2/h6H,2,5,7-10H2,1,3-4H3 |
| InChIKey | AHEGLKHZXUIROV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|