C23H46O8Si2 — CID 88604956
[dibutoxy(methyl)silyl]methyl 2-methylprop-2-enoate;3-[dimethoxy(methyl)silyl]propyl prop-2-enoate (PubChem CID 88604956) has the molecular formula C23H46O8Si2 and a molecular weight of 506.79 g/mol. Its IUPAC name is [dibutoxy(methyl)silyl]methyl 2-methylprop-2-enoate;3-[dimethoxy(methyl)silyl]propyl prop-2-enoate.
| Compound Name | [dibutoxy(methyl)silyl]methyl 2-methylprop-2-enoate;3-[dimethoxy(methyl)silyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 88604956 |
| Molecular Formula | C23H46O8Si2 |
| Molecular Weight | 506.79 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | [dibutoxy(methyl)silyl]methyl 2-methylprop-2-enoate;3-[dimethoxy(methyl)silyl]propyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC[Si](C)(OCCCC)OCCCC.C=CC(=O)OCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C14H28O4Si.C9H18O4Si/c1-6-8-10-17-19(5,18-11-9-7-2)12-16-14(15)13(3)4;1-5-9(10)13-7-6-8-14(4,11-2)12-3/h3,6-12H2,1-2,4-5H3;5H,1,6-8H2,2-4H3 |
| InChIKey | PBIRFXDZYPBULS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.79 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|