About 3-trimethoxysilylpropyl prop-2-enoate;hydrate
3-trimethoxysilylpropyl prop-2-enoate;hydrate (PubChem CID 141437630) has the molecular formula C9H20O6Si
and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-trimethoxysilylpropyl prop-2-enoate;hydrate.
Molecular Properties
| Compound Name | 3-trimethoxysilylpropyl prop-2-enoate;hydrate |
| PubChem CID | 141437630 |
| Molecular Formula | C9H20O6Si |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-trimethoxysilylpropyl prop-2-enoate;hydrate |
| SMILES | C=CC(=O)OCCC[Si](OC)(OC)OC.O |
| InChI | InChI=1S/C9H18O5Si.H2O/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4;/h5H,1,6-8H2,2-4H3;1H2 |
| InChIKey | XADNZBCJRTYZGK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 85.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethoxysilylpropyl prop-2-enoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethoxysilylpropyl prop-2-enoate;hydrate?
The IUPAC name of 3-trimethoxysilylpropyl prop-2-enoate;hydrate (CID 141437630) is 3-trimethoxysilylpropyl prop-2-enoate;hydrate.
What is the SMILES notation for 3-trimethoxysilylpropyl prop-2-enoate;hydrate?
The canonical SMILES for 3-trimethoxysilylpropyl prop-2-enoate;hydrate is C=CC(=O)OCCC[Si](OC)(OC)OC.O.
What is the InChIKey of 3-trimethoxysilylpropyl prop-2-enoate;hydrate?
The InChIKey is XADNZBCJRTYZGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O5Si.H2O/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4;/h5H,1,6-8H2,2-4H3;1H2.
What are the key properties of 3-trimethoxysilylpropyl prop-2-enoate;hydrate?
3-trimethoxysilylpropyl prop-2-enoate;hydrate has a molecular weight of 252.34 g/mol, XLogP of 0.16, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethoxysilylpropyl prop-2-enoate;hydrate is sourced from PubChem (CID 141437630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).