C18H36O9Si2 — CID 173157116
(4,4-dimethoxy-4-silylbutyl) prop-2-enoate;3-trimethoxysilylpropyl prop-2-enoate (PubChem CID 173157116) has the molecular formula C18H36O9Si2 and a molecular weight of 452.65 g/mol. Its IUPAC name is (4,4-dimethoxy-4-silylbutyl) prop-2-enoate;3-trimethoxysilylpropyl prop-2-enoate.
| Compound Name | (4,4-dimethoxy-4-silylbutyl) prop-2-enoate;3-trimethoxysilylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 173157116 |
| Molecular Formula | C18H36O9Si2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (4,4-dimethoxy-4-silylbutyl) prop-2-enoate;3-trimethoxysilylpropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC([SiH3])(OC)OC.C=CC(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C9H18O5Si.C9H18O4Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4;1-4-8(10)13-7-5-6-9(14,11-2)12-3/h5H,1,6-8H2,2-4H3;4H,1,5-7H2,2-3,14H3 |
| InChIKey | GNIUKZCIEDMBNR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|