About 3-tripentoxysilylpropyl prop-2-enoate
3-tripentoxysilylpropyl prop-2-enoate (PubChem CID 151204895) has the molecular formula C21H42O5Si
and a molecular weight of 402.65 g/mol. Its IUPAC name is 3-tripentoxysilylpropyl prop-2-enoate.
Molecular Properties
| Compound Name | 3-tripentoxysilylpropyl prop-2-enoate |
| PubChem CID | 151204895 |
| Molecular Formula | C21H42O5Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 3-tripentoxysilylpropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](OCCCCC)(OCCCCC)OCCCCC |
| InChI | InChI=1S/C21H42O5Si/c1-5-9-12-17-24-27(25-18-13-10-6-2,26-19-14-11-7-3)20-15-16-23-21(22)8-4/h8H,4-7,9-20H2,1-3H3 |
| InChIKey | NJBLZVPJQLYSGG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-tripentoxysilylpropyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tripentoxysilylpropyl prop-2-enoate?
The IUPAC name of 3-tripentoxysilylpropyl prop-2-enoate (CID 151204895) is 3-tripentoxysilylpropyl prop-2-enoate.
What is the SMILES notation for 3-tripentoxysilylpropyl prop-2-enoate?
The canonical SMILES for 3-tripentoxysilylpropyl prop-2-enoate is C=CC(=O)OCCC[Si](OCCCCC)(OCCCCC)OCCCCC.
What is the InChIKey of 3-tripentoxysilylpropyl prop-2-enoate?
The InChIKey is NJBLZVPJQLYSGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O5Si/c1-5-9-12-17-24-27(25-18-13-10-6-2,26-19-14-11-7-3)20-15-16-23-21(22)8-4/h8H,4-7,9-20H2,1-3H3.
What are the key properties of 3-tripentoxysilylpropyl prop-2-enoate?
3-tripentoxysilylpropyl prop-2-enoate has a molecular weight of 402.65 g/mol, XLogP of 5.66, 20 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tripentoxysilylpropyl prop-2-enoate is sourced from PubChem (CID 151204895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).