C15H28O7Si — CID 158718289
prop-2-enoic acid;3-triethoxysilylpropyl prop-2-enoate (PubChem CID 158718289) has the molecular formula C15H28O7Si and a molecular weight of 348.47 g/mol. Its IUPAC name is prop-2-enoic acid;3-triethoxysilylpropyl prop-2-enoate.
| Compound Name | prop-2-enoic acid;3-triethoxysilylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 158718289 |
| Molecular Formula | C15H28O7Si |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | prop-2-enoic acid;3-triethoxysilylpropyl prop-2-enoate |
| SMILES | C=CC(=O)O.C=CC(=O)OCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C12H24O5Si.C3H4O2/c1-5-12(13)14-10-9-11-18(15-6-2,16-7-3)17-8-4;1-2-3(4)5/h5H,1,6-11H2,2-4H3;2H,1H2,(H,4,5) |
| InChIKey | IJPDBAATEHKHJI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|