C16H32O7Si — CID 172786041
3-[(1,5-dihydroxy-3-methylpentan-3-yl)oxy-diethoxysilyl]propyl prop-2-enoate (PubChem CID 172786041) has the molecular formula C16H32O7Si and a molecular weight of 364.51 g/mol. Its IUPAC name is 3-[(1,5-dihydroxy-3-methylpentan-3-yl)oxy-diethoxysilyl]propyl prop-2-enoate.
| Compound Name | 3-[(1,5-dihydroxy-3-methylpentan-3-yl)oxy-diethoxysilyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 172786041 |
| Molecular Formula | C16H32O7Si |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-[(1,5-dihydroxy-3-methylpentan-3-yl)oxy-diethoxysilyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](OCC)(OCC)OC(C)(CCO)CCO |
| InChI | InChI=1S/C16H32O7Si/c1-5-15(19)20-13-8-14-24(21-6-2,22-7-3)23-16(4,9-11-17)10-12-18/h5,17-18H,1,6-14H2,2-4H3 |
| InChIKey | OXDWYFFUTZCZCW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|