C14H31NO6Si — CID 160531535
4-[(1,5-dihydroxy-3-methylpentan-3-yl)oxy-diethoxysilyl]butanamide (PubChem CID 160531535) has the molecular formula C14H31NO6Si and a molecular weight of 337.49 g/mol. Its IUPAC name is 4-[(1,5-dihydroxy-3-methylpentan-3-yl)oxy-diethoxysilyl]butanamide.
| Compound Name | 4-[(1,5-dihydroxy-3-methylpentan-3-yl)oxy-diethoxysilyl]butanamide |
|---|---|
| PubChem CID | 160531535 |
| Molecular Formula | C14H31NO6Si |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 4-[(1,5-dihydroxy-3-methylpentan-3-yl)oxy-diethoxysilyl]butanamide |
| SMILES | CCO[Si](CCCC(N)=O)(OCC)OC(C)(CCO)CCO |
| InChI | InChI=1S/C14H31NO6Si/c1-4-19-22(20-5-2,12-6-7-13(15)18)21-14(3,8-10-16)9-11-17/h16-17H,4-12H2,1-3H3,(H2,15,18) |
| InChIKey | QVPJWCJZCBFDAO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|