About ethyl carbamate;3-triethoxysilylpropan-1-amine
ethyl carbamate;3-triethoxysilylpropan-1-amine (PubChem CID 90205560) has the molecular formula C12H30N2O5Si
and a molecular weight of 310.47 g/mol. Its IUPAC name is ethyl carbamate;3-triethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | ethyl carbamate;3-triethoxysilylpropan-1-amine |
| PubChem CID | 90205560 |
| Molecular Formula | C12H30N2O5Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | ethyl carbamate;3-triethoxysilylpropan-1-amine |
| SMILES | CCOC(N)=O.CCO[Si](CCCN)(OCC)OCC |
| InChI | InChI=1S/C9H23NO3Si.C3H7NO2/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-2-6-3(4)5/h4-10H2,1-3H3;2H2,1H3,(H2,4,5) |
| InChIKey | PNXAAIPUDTZTSD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl carbamate;3-triethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl carbamate;3-triethoxysilylpropan-1-amine?
The IUPAC name of ethyl carbamate;3-triethoxysilylpropan-1-amine (CID 90205560) is ethyl carbamate;3-triethoxysilylpropan-1-amine.
What is the SMILES notation for ethyl carbamate;3-triethoxysilylpropan-1-amine?
The canonical SMILES for ethyl carbamate;3-triethoxysilylpropan-1-amine is CCOC(N)=O.CCO[Si](CCCN)(OCC)OCC.
What is the InChIKey of ethyl carbamate;3-triethoxysilylpropan-1-amine?
The InChIKey is PNXAAIPUDTZTSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NO3Si.C3H7NO2/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-2-6-3(4)5/h4-10H2,1-3H3;2H2,1H3,(H2,4,5).
What are the key properties of ethyl carbamate;3-triethoxysilylpropan-1-amine?
ethyl carbamate;3-triethoxysilylpropan-1-amine has a molecular weight of 310.47 g/mol, XLogP of 1.49, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbamate;3-triethoxysilylpropan-1-amine is sourced from PubChem (CID 90205560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).