About silane;3-triethoxysilylpropylurea
silane;3-triethoxysilylpropylurea (PubChem CID 161180470) has the molecular formula C10H28N2O4Si2
and a molecular weight of 296.52 g/mol. Its IUPAC name is silane;3-triethoxysilylpropylurea.
Molecular Properties
| Compound Name | silane;3-triethoxysilylpropylurea |
| PubChem CID | 161180470 |
| Molecular Formula | C10H28N2O4Si2 |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | silane;3-triethoxysilylpropylurea |
| SMILES | CCO[Si](CCCNC(N)=O)(OCC)OCC.[SiH4] |
| InChI | InChI=1S/C10H24N2O4Si.H4Si/c1-4-14-17(15-5-2,16-6-3)9-7-8-12-10(11)13;/h4-9H2,1-3H3,(H3,11,12,13);1H4 |
| InChIKey | USJNXSKTHZGXJF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silane;3-triethoxysilylpropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silane;3-triethoxysilylpropylurea?
The IUPAC name of silane;3-triethoxysilylpropylurea (CID 161180470) is silane;3-triethoxysilylpropylurea.
What is the SMILES notation for silane;3-triethoxysilylpropylurea?
The canonical SMILES for silane;3-triethoxysilylpropylurea is CCO[Si](CCCNC(N)=O)(OCC)OCC.[SiH4].
What is the InChIKey of silane;3-triethoxysilylpropylurea?
The InChIKey is USJNXSKTHZGXJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2O4Si.H4Si/c1-4-14-17(15-5-2,16-6-3)9-7-8-12-10(11)13;/h4-9H2,1-3H3,(H3,11,12,13);1H4.
What are the key properties of silane;3-triethoxysilylpropylurea?
silane;3-triethoxysilylpropylurea has a molecular weight of 296.52 g/mol, XLogP of -0.36, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silane;3-triethoxysilylpropylurea is sourced from PubChem (CID 161180470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).