C26H58N4O8Si2 — CID 87657796
1-(3-triethoxysilylpropyl)-3-[6-(3-triethoxysilylpropylcarbamoylamino)hexyl]urea (PubChem CID 87657796) has the molecular formula C26H58N4O8Si2 and a molecular weight of 610.94 g/mol. Its IUPAC name is 1-(3-triethoxysilylpropyl)-3-[6-(3-triethoxysilylpropylcarbamoylamino)hexyl]urea.
| Compound Name | 1-(3-triethoxysilylpropyl)-3-[6-(3-triethoxysilylpropylcarbamoylamino)hexyl]urea |
|---|---|
| PubChem CID | 87657796 |
| Molecular Formula | C26H58N4O8Si2 |
| Molecular Weight | 610.94 g/mol |
| Exact Mass | 610.38 |
| IUPAC Name | 1-(3-triethoxysilylpropyl)-3-[6-(3-triethoxysilylpropylcarbamoylamino)hexyl]urea |
| SMILES | CCO[Si](CCCNC(=O)NCCCCCCNC(=O)NCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C26H58N4O8Si2/c1-7-33-39(34-8-2,35-9-3)23-17-21-29-25(31)27-19-15-13-14-16-20-28-26(32)30-22-18-24-40(36-10-4,37-11-5)38-12-6/h7-24H2,1-6H3,(H2,27,29,31)(H2,28,30,32) |
| InChIKey | UOOOGHRJGWPZBF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 137.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.94 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|