C15H35N2O4Si2 — CID 102321543
CID 102321543 (PubChem CID 102321543) has the molecular formula C15H35N2O4Si2 and a molecular weight of 363.63 g/mol.
| Compound Name | CID 102321543 |
|---|---|
| PubChem CID | 102321543 |
| Molecular Formula | C15H35N2O4Si2 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | — |
| SMILES | CCO[Si](CCCNC(=O)NCCC[Si](C)C)(OCC)OCC |
| InChI | InChI=1S/C15H35N2O4Si2/c1-6-19-23(20-7-2,21-8-3)14-10-12-17-15(18)16-11-9-13-22(4)5/h6-14H2,1-5H3,(H2,16,17,18) |
| InChIKey | PXPLBEVGSZXRPP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|