C51H105N9O15Si3 — CID 100991329
1-(3-triethoxysilylpropyl)-3-[6-[2,4,6-trioxo-3,5-bis[6-(3-triethoxysilylpropylcarbamoylamino)hexyl]-1,3,5-triazinan-1-yl]hexyl]urea (PubChem CID 100991329) has the molecular formula C51H105N9O15Si3 and a molecular weight of 1168.71 g/mol. Its IUPAC name is 1-(3-triethoxysilylpropyl)-3-[6-[2,4,6-trioxo-3,5-bis[6-(3-triethoxysilylpropylcarbamoylamino)hexyl]-1,3,5-triazinan-1-yl]hexyl]urea.
| Compound Name | 1-(3-triethoxysilylpropyl)-3-[6-[2,4,6-trioxo-3,5-bis[6-(3-triethoxysilylpropylcarbamoylamino)hexyl]-1,3,5-triazinan-1-yl]hexyl]urea |
|---|---|
| PubChem CID | 100991329 |
| Molecular Formula | C51H105N9O15Si3 |
| Molecular Weight | 1168.71 g/mol |
| Exact Mass | 1167.70 |
| IUPAC Name | 1-(3-triethoxysilylpropyl)-3-[6-[2,4,6-trioxo-3,5-bis[6-(3-triethoxysilylpropylcarbamoylamino)hexyl]-1,3,5-triazinan-1-yl]hexyl]urea |
| SMILES | CCO[Si](CCCNC(=O)NCCCCCCn1c(=O)n(CCCCCCNC(=O)NCCC[Si](OCC)(OCC)OCC)c(=O)n(CCCCCCNC(=O)NCCC[Si](OCC)(OCC)OCC)c1=O)(OCC)OCC |
| InChI | InChI=1S/C51H105N9O15Si3/c1-10-67-76(68-11-2,69-12-3)43-31-37-55-46(61)52-34-25-19-22-28-40-58-49(64)59(41-29-23-20-26-35-53-47(62)56-38-32-44-77(70-13-4,71-14-5)72-15-6)51(66)60(50(58)65)42-30-24-21-27-36-54-48(63)57-39-33-45-78(73-16-7,74-17-8)75-18-9/h10-45H2,1-9H3,(H2,52,55,61)(H2,53,56,62)(H2,54,57,63) |
| InChIKey | YERZNSRFPNMPCY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 272.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 78 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1168.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|