C33H55N5O9Si2 — CID 155657712
4-(3-triethoxysilylpropylcarbamoylamino)-N-[4-(3-triethoxysilylpropylcarbamoylamino)phenyl]benzamide (PubChem CID 155657712) has the molecular formula C33H55N5O9Si2 and a molecular weight of 722.00 g/mol. Its IUPAC name is 4-(3-triethoxysilylpropylcarbamoylamino)-N-[4-(3-triethoxysilylpropylcarbamoylamino)phenyl]benzamide.
| Compound Name | 4-(3-triethoxysilylpropylcarbamoylamino)-N-[4-(3-triethoxysilylpropylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 155657712 |
| Molecular Formula | C33H55N5O9Si2 |
| Molecular Weight | 722.00 g/mol |
| Exact Mass | 721.35 |
| IUPAC Name | 4-(3-triethoxysilylpropylcarbamoylamino)-N-[4-(3-triethoxysilylpropylcarbamoylamino)phenyl]benzamide |
| SMILES | CCO[Si](CCCNC(=O)Nc1ccc(NC(=O)c2ccc(NC(=O)NCCC[Si](OCC)(OCC)OCC)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C33H55N5O9Si2/c1-7-42-48(43-8-2,44-9-3)25-13-23-34-32(40)37-29-17-15-27(16-18-29)31(39)36-28-19-21-30(22-20-28)38-33(41)35-24-14-26-49(45-10-4,46-11-5)47-12-6/h15-22H,7-14,23-26H2,1-6H3,(H,36,39)(H2,34,37,40)(H2,35,38,41) |
| InChIKey | ALLPWHHOACMTDU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 166.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.00 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|