C44H66N4O12Si2 — CID 25031392
1-[6-(methoxymethoxy)-5-[2-(methoxymethoxy)-6-(3-triethoxysilylpropylcarbamoylamino)naphthalen-1-yl]naphthalen-2-yl]-3-(3-triethoxysilylpropyl)urea (PubChem CID 25031392) has the molecular formula C44H66N4O12Si2 and a molecular weight of 899.20 g/mol. Its IUPAC name is 1-[6-(methoxymethoxy)-5-[2-(methoxymethoxy)-6-(3-triethoxysilylpropylcarbamoylamino)naphthalen-1-yl]naphthalen-2-yl]-3-(3-triethoxysilylpropyl)urea.
| Compound Name | 1-[6-(methoxymethoxy)-5-[2-(methoxymethoxy)-6-(3-triethoxysilylpropylcarbamoylamino)naphthalen-1-yl]naphthalen-2-yl]-3-(3-triethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 25031392 |
| Molecular Formula | C44H66N4O12Si2 |
| Molecular Weight | 899.20 g/mol |
| Exact Mass | 898.42 |
| IUPAC Name | 1-[6-(methoxymethoxy)-5-[2-(methoxymethoxy)-6-(3-triethoxysilylpropylcarbamoylamino)naphthalen-1-yl]naphthalen-2-yl]-3-(3-triethoxysilylpropyl)urea |
| SMILES | CCO[Si](CCCNC(=O)Nc1ccc2c(-c3c(OCOC)ccc4cc(NC(=O)NCCC[Si](OCC)(OCC)OCC)ccc34)c(OCOC)ccc2c1)(OCC)OCC |
| InChI | InChI=1S/C44H66N4O12Si2/c1-9-55-61(56-10-2,57-11-3)27-15-25-45-43(49)47-35-19-21-37-33(29-35)17-23-39(53-31-51-7)41(37)42-38-22-20-36(30-34(38)18-24-40(42)54-32-52-8)48-44(50)46-26-16-28-62(58-12-4,59-13-5)60-14-6/h17-24,29-30H,9-16,25-28,31-32H2,1-8H3,(H2,45,47,49)(H2,46,48,50) |
| InChIKey | RGVKYYWZGDNWCF-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 174.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.20 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|