C16H23N3O4Si — CID 140892825
1-quinolin-3-yl-3-(3-trimethoxysilylpropyl)urea (PubChem CID 140892825) has the molecular formula C16H23N3O4Si and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-quinolin-3-yl-3-(3-trimethoxysilylpropyl)urea.
| Compound Name | 1-quinolin-3-yl-3-(3-trimethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 140892825 |
| Molecular Formula | C16H23N3O4Si |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-quinolin-3-yl-3-(3-trimethoxysilylpropyl)urea |
| SMILES | CO[Si](CCCNC(=O)Nc1cnc2ccccc2c1)(OC)OC |
| InChI | InChI=1S/C16H23N3O4Si/c1-21-24(22-2,23-3)10-6-9-17-16(20)19-14-11-13-7-4-5-8-15(13)18-12-14/h4-5,7-8,11-12H,6,9-10H2,1-3H3,(H2,17,19,20) |
| InChIKey | HKOPHRSSHBAJLX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|