C18H17N3O3 — CID 16645779
1-(3,5-dimethoxyphenyl)-3-quinolin-3-ylurea (PubChem CID 16645779) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-quinolin-3-ylurea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-quinolin-3-ylurea |
|---|---|
| PubChem CID | 16645779 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-quinolin-3-ylurea |
| SMILES | COc1cc(NC(=O)Nc2cnc3ccccc3c2)cc(OC)c1 |
| InChI | InChI=1S/C18H17N3O3/c1-23-15-8-13(9-16(10-15)24-2)20-18(22)21-14-7-12-5-3-4-6-17(12)19-11-14/h3-11H,1-2H3,(H2,20,21,22) |
| InChIKey | PMKIWFWGIOWDCC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |