C19H18N2O4 — CID 18146468
2,4,5-trimethoxy-N-quinolin-3-ylbenzamide (PubChem CID 18146468) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-quinolin-3-ylbenzamide.
| Compound Name | 2,4,5-trimethoxy-N-quinolin-3-ylbenzamide |
|---|---|
| PubChem CID | 18146468 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2,4,5-trimethoxy-N-quinolin-3-ylbenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2cnc3ccccc3c2)cc1OC |
| InChI | InChI=1S/C19H18N2O4/c1-23-16-10-18(25-3)17(24-2)9-14(16)19(22)21-13-8-12-6-4-5-7-15(12)20-11-13/h4-11H,1-3H3,(H,21,22) |
| InChIKey | WLRZRFYHJFBSPF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |