C20H19N3O4 — CID 142827920
N-[4,5-dimethoxy-2-(methylcarbamoyl)phenyl]quinoline-3-carboxamide (PubChem CID 142827920) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-[4,5-dimethoxy-2-(methylcarbamoyl)phenyl]quinoline-3-carboxamide.
| Compound Name | N-[4,5-dimethoxy-2-(methylcarbamoyl)phenyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 142827920 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[4,5-dimethoxy-2-(methylcarbamoyl)phenyl]quinoline-3-carboxamide |
| SMILES | CNC(=O)c1cc(OC)c(OC)cc1NC(=O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C20H19N3O4/c1-21-20(25)14-9-17(26-2)18(27-3)10-16(14)23-19(24)13-8-12-6-4-5-7-15(12)22-11-13/h4-11H,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | DSGVGKBTITZQEP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |