C17H17FN2O4 — CID 34366934
2-[(4-fluorobenzoyl)amino]-4,5-dimethoxy-N-methylbenzamide (PubChem CID 34366934) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-[(4-fluorobenzoyl)amino]-4,5-dimethoxy-N-methylbenzamide.
| Compound Name | 2-[(4-fluorobenzoyl)amino]-4,5-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 34366934 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[(4-fluorobenzoyl)amino]-4,5-dimethoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(OC)c(OC)cc1NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O4/c1-19-17(22)12-8-14(23-2)15(24-3)9-13(12)20-16(21)10-4-6-11(18)7-5-10/h4-9H,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | DPCVXWPLRVZLBN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |