C19H18FNO6 — CID 108795600
2-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 108795600) has the molecular formula C19H18FNO6 and a molecular weight of 375.35 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 108795600 |
| Molecular Formula | C19H18FNO6 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)CCC(=O)c2ccc(F)cc2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C19H18FNO6/c1-26-16-9-13(19(24)25)14(10-17(16)27-2)21-18(23)8-7-15(22)11-3-5-12(20)6-4-11/h3-6,9-10H,7-8H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | GGGMXSQWOJXDPD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |