C16H15FN2O5 — CID 16774686
2-[(4-fluorophenyl)carbamoylamino]-4,5-dimethoxybenzoic acid (PubChem CID 16774686) has the molecular formula C16H15FN2O5 and a molecular weight of 334.30 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)carbamoylamino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[(4-fluorophenyl)carbamoylamino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 16774686 |
| Molecular Formula | C16H15FN2O5 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[(4-fluorophenyl)carbamoylamino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)Nc2ccc(F)cc2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C16H15FN2O5/c1-23-13-7-11(15(20)21)12(8-14(13)24-2)19-16(22)18-10-5-3-9(17)4-6-10/h3-8H,1-2H3,(H,20,21)(H2,18,19,22) |
| InChIKey | GETCEXNPHHDAPR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |