C15H10F4N2O3 — CID 57011310
5-fluoro-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]benzoic acid (PubChem CID 57011310) has the molecular formula C15H10F4N2O3 and a molecular weight of 342.25 g/mol. Its IUPAC name is 5-fluoro-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]benzoic acid.
| Compound Name | 5-fluoro-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 57011310 |
| Molecular Formula | C15H10F4N2O3 |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 5-fluoro-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]benzoic acid |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C15H10F4N2O3/c16-9-3-6-12(11(7-9)13(22)23)21-14(24)20-10-4-1-8(2-5-10)15(17,18)19/h1-7H,(H,22,23)(H2,20,21,24) |
| InChIKey | KRPSLGFGJWAPAJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |