C10H7F4NO3 — CID 24711242
5-fluoro-2-(3,3,3-trifluoropropanoylamino)benzoic acid (PubChem CID 24711242) has the molecular formula C10H7F4NO3 and a molecular weight of 265.16 g/mol. Its IUPAC name is 5-fluoro-2-(3,3,3-trifluoropropanoylamino)benzoic acid.
| Compound Name | 5-fluoro-2-(3,3,3-trifluoropropanoylamino)benzoic acid |
|---|---|
| PubChem CID | 24711242 |
| Molecular Formula | C10H7F4NO3 |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 5-fluoro-2-(3,3,3-trifluoropropanoylamino)benzoic acid |
| SMILES | O=C(CC(F)(F)F)Nc1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C10H7F4NO3/c11-5-1-2-7(6(3-5)9(17)18)15-8(16)4-10(12,13)14/h1-3H,4H2,(H,15,16)(H,17,18) |
| InChIKey | CICAUDFDZZKZCG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |