C10H7F4NO4 — CID 61170206
5-fluoro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid (PubChem CID 61170206) has the molecular formula C10H7F4NO4 and a molecular weight of 281.16 g/mol. Its IUPAC name is 5-fluoro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid.
| Compound Name | 5-fluoro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 61170206 |
| Molecular Formula | C10H7F4NO4 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 5-fluoro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(F)cc1C(=O)O)OCC(F)(F)F |
| InChI | InChI=1S/C10H7F4NO4/c11-5-1-2-7(6(3-5)8(16)17)15-9(18)19-4-10(12,13)14/h1-3H,4H2,(H,15,18)(H,16,17) |
| InChIKey | FBBZXGVAVMCXIU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |