C10H7Cl3INO4 — CID 22046709
5-iodo-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid (PubChem CID 22046709) has the molecular formula C10H7Cl3INO4 and a molecular weight of 438.43 g/mol. Its IUPAC name is 5-iodo-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid.
| Compound Name | 5-iodo-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 22046709 |
| Molecular Formula | C10H7Cl3INO4 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 436.85 |
| IUPAC Name | 5-iodo-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(I)cc1C(=O)O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H7Cl3INO4/c11-10(12,13)4-19-9(18)15-7-2-1-5(14)3-6(7)8(16)17/h1-3H,4H2,(H,15,18)(H,16,17) |
| InChIKey | WWZSMPGWHZPCDT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|