C9H9IN2O3 — CID 63111629
5-iodo-2-(methylcarbamoylamino)benzoic acid (PubChem CID 63111629) has the molecular formula C9H9IN2O3 and a molecular weight of 320.09 g/mol. Its IUPAC name is 5-iodo-2-(methylcarbamoylamino)benzoic acid.
| Compound Name | 5-iodo-2-(methylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 63111629 |
| Molecular Formula | C9H9IN2O3 |
| Molecular Weight | 320.09 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 5-iodo-2-(methylcarbamoylamino)benzoic acid |
| SMILES | CNC(=O)Nc1ccc(I)cc1C(=O)O |
| InChI | InChI=1S/C9H9IN2O3/c1-11-9(15)12-7-3-2-5(10)4-6(7)8(13)14/h2-4H,1H3,(H,13,14)(H2,11,12,15) |
| InChIKey | DDKYPGWMCLZQSV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.09 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|