C10H9F2IN2O3 — CID 115408168
2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid (PubChem CID 115408168) has the molecular formula C10H9F2IN2O3 and a molecular weight of 370.09 g/mol. Its IUPAC name is 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid.
| Compound Name | 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid |
|---|---|
| PubChem CID | 115408168 |
| Molecular Formula | C10H9F2IN2O3 |
| Molecular Weight | 370.09 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid |
| SMILES | O=C(NCC(F)F)Nc1ccc(I)cc1C(=O)O |
| InChI | InChI=1S/C10H9F2IN2O3/c11-8(12)4-14-10(18)15-7-2-1-5(13)3-6(7)9(16)17/h1-3,8H,4H2,(H,16,17)(H2,14,15,18) |
| InChIKey | USASYDYBNDXREI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.09 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|