2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid

C10H9F2IN2O3 — CID 115408168

IUPAC2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid
SMILESO=C(NCC(F)F)Nc1ccc(I)cc1C(=O)O
InChIInChI=1S/C10H9F2IN2O3/c11-8(12)4-14-10(18)15-7-2-1-5(13)3-6(7)9(16)17/h1-3,8H,4H2,(H,16,17)(H2,14,15,18)
InChIKeyUSASYDYBNDXREI-UHFFFAOYSA-N
MW370.09 g/mol
LogP2.38
Rot. Bonds4

About 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid

2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid (PubChem CID 115408168) has the molecular formula C10H9F2IN2O3 and a molecular weight of 370.09 g/mol. Its IUPAC name is 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid.

Molecular Properties

Compound Name2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid
PubChem CID115408168
Molecular FormulaC10H9F2IN2O3
Molecular Weight370.09 g/mol
Exact Mass369.96
IUPAC Name2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid
SMILESO=C(NCC(F)F)Nc1ccc(I)cc1C(=O)O
InChIInChI=1S/C10H9F2IN2O3/c11-8(12)4-14-10(18)15-7-2-1-5(13)3-6(7)9(16)17/h1-3,8H,4H2,(H,16,17)(H2,14,15,18)
InChIKeyUSASYDYBNDXREI-UHFFFAOYSA-N
XLogP2.38
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500370.09
LogP ≤ 52.38
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid?
The IUPAC name of 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid (CID 115408168) is 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid.
What is the SMILES notation for 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid?
The canonical SMILES for 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid is O=C(NCC(F)F)Nc1ccc(I)cc1C(=O)O.
What is the InChIKey of 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid?
The InChIKey is USASYDYBNDXREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2IN2O3/c11-8(12)4-14-10(18)15-7-2-1-5(13)3-6(7)9(16)17/h1-3,8H,4H2,(H,16,17)(H2,14,15,18).
What are the key properties of 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid?
2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid has a molecular weight of 370.09 g/mol, XLogP of 2.38, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethylcarbamoylamino)-5-iodobenzoic acid is sourced from PubChem (CID 115408168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).