C11H11IN2O5 — CID 63111670
5-iodo-2-[(2-methoxy-2-oxoethyl)carbamoylamino]benzoic acid (PubChem CID 63111670) has the molecular formula C11H11IN2O5 and a molecular weight of 378.12 g/mol. Its IUPAC name is 5-iodo-2-[(2-methoxy-2-oxoethyl)carbamoylamino]benzoic acid.
| Compound Name | 5-iodo-2-[(2-methoxy-2-oxoethyl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 63111670 |
| Molecular Formula | C11H11IN2O5 |
| Molecular Weight | 378.12 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 5-iodo-2-[(2-methoxy-2-oxoethyl)carbamoylamino]benzoic acid |
| SMILES | COC(=O)CNC(=O)Nc1ccc(I)cc1C(=O)O |
| InChI | InChI=1S/C11H11IN2O5/c1-19-9(15)5-13-11(18)14-8-3-2-6(12)4-7(8)10(16)17/h2-4H,5H2,1H3,(H,16,17)(H2,13,14,18) |
| InChIKey | YBSKNDCKUAVFHC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.12 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|