C11H14IN3O5S — CID 106340545
5-iodo-2-[2-(methylsulfamoyl)ethylcarbamoylamino]benzoic acid (PubChem CID 106340545) has the molecular formula C11H14IN3O5S and a molecular weight of 427.22 g/mol. Its IUPAC name is 5-iodo-2-[2-(methylsulfamoyl)ethylcarbamoylamino]benzoic acid.
| Compound Name | 5-iodo-2-[2-(methylsulfamoyl)ethylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 106340545 |
| Molecular Formula | C11H14IN3O5S |
| Molecular Weight | 427.22 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 5-iodo-2-[2-(methylsulfamoyl)ethylcarbamoylamino]benzoic acid |
| SMILES | CNS(=O)(=O)CCNC(=O)Nc1ccc(I)cc1C(=O)O |
| InChI | InChI=1S/C11H14IN3O5S/c1-13-21(19,20)5-4-14-11(18)15-9-3-2-7(12)6-8(9)10(16)17/h2-3,6,13H,4-5H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | ORSNBDZNGHYMCI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|